C21H18FN3O2 — CID 175599487
3-(3-fluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)propanamide (PubChem CID 175599487) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)propanamide.
| Compound Name | 3-(3-fluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)propanamide |
|---|---|
| PubChem CID | 175599487 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)propanamide |
| SMILES | COc1ccc2c(c1)[nH]c1c(NC(=O)CCc3cccc(F)c3)nccc12 |
| InChI | InChI=1S/C21H18FN3O2/c1-27-15-6-7-16-17-9-10-23-21(20(17)24-18(16)12-15)25-19(26)8-5-13-3-2-4-14(22)11-13/h2-4,6-7,9-12,24H,5,8H2,1H3,(H,23,25,26) |
| InChIKey | XDSYLSLWXKPSHV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |