C20H15F2N3O2 — CID 175599474
2-(2,4-difluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)acetamide (PubChem CID 175599474) has the molecular formula C20H15F2N3O2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)acetamide |
|---|---|
| PubChem CID | 175599474 |
| Molecular Formula | C20H15F2N3O2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-(7-methoxy-9H-pyrido[3,4-b]indol-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)[nH]c1c(NC(=O)Cc3ccc(F)cc3F)nccc12 |
| InChI | InChI=1S/C20H15F2N3O2/c1-27-13-4-5-14-15-6-7-23-20(19(15)24-17(14)10-13)25-18(26)8-11-2-3-12(21)9-16(11)22/h2-7,9-10,24H,8H2,1H3,(H,23,25,26) |
| InChIKey | VVIUJJDHWSVTGT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |