About 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide
7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 170555357) has the molecular formula C14H10FN7O
and a molecular weight of 311.28 g/mol. Its IUPAC name is 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide.
Molecular Properties
| Compound Name | 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide |
| PubChem CID | 170555357 |
| Molecular Formula | C14H10FN7O |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | O=C(NCc1nn[nH]n1)c1nccc2c1[nH]c1cc(F)ccc12 |
| InChI | InChI=1S/C14H10FN7O/c15-7-1-2-8-9-3-4-16-13(12(9)18-10(8)5-7)14(23)17-6-11-19-21-22-20-11/h1-5,18H,6H2,(H,17,23)(H,19,20,21,22) |
| InChIKey | CCEMRQVQIGIMAU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
The IUPAC name of 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide (CID 170555357) is 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide.
What is the SMILES notation for 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
The canonical SMILES for 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide is O=C(NCc1nn[nH]n1)c1nccc2c1[nH]c1cc(F)ccc12.
What is the InChIKey of 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
The InChIKey is CCEMRQVQIGIMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN7O/c15-7-1-2-8-9-3-4-16-13(12(9)18-10(8)5-7)14(23)17-6-11-19-21-22-20-11/h1-5,18H,6H2,(H,17,23)(H,19,20,21,22).
What are the key properties of 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide?
7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide has a molecular weight of 311.28 g/mol, XLogP of 1.30, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N-(2H-tetrazol-5-ylmethyl)-9H-pyrido[3,4-b]indole-1-carboxamide is sourced from PubChem (CID 170555357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).