C9H6F2N6O3 — CID 107121999
2,5-difluoro-3-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 107121999) has the molecular formula C9H6F2N6O3 and a molecular weight of 284.18 g/mol. Its IUPAC name is 2,5-difluoro-3-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 2,5-difluoro-3-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107121999 |
| Molecular Formula | C9H6F2N6O3 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2,5-difluoro-3-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1nn[nH]n1)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H6F2N6O3/c10-4-1-5(8(11)6(2-4)17(19)20)9(18)12-3-7-13-15-16-14-7/h1-2H,3H2,(H,12,18)(H,13,14,15,16) |
| InChIKey | IXEZRWNCDGFWBS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|