C9H6F3N5O — CID 65100923
2,4,6-trifluoro-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 65100923) has the molecular formula C9H6F3N5O and a molecular weight of 257.18 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 2,4,6-trifluoro-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 65100923 |
| Molecular Formula | C9H6F3N5O |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2,4,6-trifluoro-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1nn[nH]n1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H6F3N5O/c10-4-1-5(11)8(6(12)2-4)9(18)13-3-7-14-16-17-15-7/h1-2H,3H2,(H,13,18)(H,14,15,16,17) |
| InChIKey | TUUGKDGJTOSUEI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |