C10H10FN5O2 — CID 81002204
4-fluoro-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 81002204) has the molecular formula C10H10FN5O2 and a molecular weight of 251.22 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 4-fluoro-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 81002204 |
| Molecular Formula | C10H10FN5O2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-fluoro-3-methoxy-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | COc1cc(C(=O)NCc2nn[nH]n2)ccc1F |
| InChI | InChI=1S/C10H10FN5O2/c1-18-8-4-6(2-3-7(8)11)10(17)12-5-9-13-15-16-14-9/h2-4H,5H2,1H3,(H,12,17)(H,13,14,15,16) |
| InChIKey | XGVIYYAWVZZVPN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |