C9H7ClN6O3 — CID 82781351
3-chloro-4-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 82781351) has the molecular formula C9H7ClN6O3 and a molecular weight of 282.65 g/mol. Its IUPAC name is 3-chloro-4-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 3-chloro-4-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 82781351 |
| Molecular Formula | C9H7ClN6O3 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-chloro-4-nitro-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1nn[nH]n1)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C9H7ClN6O3/c10-6-3-5(1-2-7(6)16(18)19)9(17)11-4-8-12-14-15-13-8/h1-3H,4H2,(H,11,17)(H,12,13,14,15) |
| InChIKey | WDQCFFKNNIOTBX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|