C17H14N2O3 — CID 162967944
ethyl 3-(7-formyl-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoate (PubChem CID 162967944) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 3-(7-formyl-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoate.
| Compound Name | ethyl 3-(7-formyl-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 162967944 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl 3-(7-formyl-9H-pyrido[3,4-b]indol-1-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1nccc2c1[nH]c1cc(C=O)ccc12 |
| InChI | InChI=1S/C17H14N2O3/c1-2-22-16(21)6-5-14-17-13(7-8-18-14)12-4-3-11(10-20)9-15(12)19-17/h3-10,19H,2H2,1H3 |
| InChIKey | TZJFCLWSCRFISB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|