C21H16N2O2 — CID 90681564
(E)-1-(4-methoxyphenyl)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one (PubChem CID 90681564) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90681564 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2nccc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C21H16N2O2/c1-25-15-8-6-14(7-9-15)20(24)11-10-19-21-17(12-13-22-19)16-4-2-3-5-18(16)23-21/h2-13,23H,1H3/b11-10+ |
| InChIKey | RTYCQDHBOOHFCV-ZHACJKMWSA-N |
| XLogP | 4.62 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|