C19H16N2O2 — CID 53321045
(4-methoxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanol (PubChem CID 53321045) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (4-methoxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanol.
| Compound Name | (4-methoxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanol |
|---|---|
| PubChem CID | 53321045 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (4-methoxyphenyl)-(9H-pyrido[3,4-b]indol-1-yl)methanol |
| SMILES | COc1ccc(C(O)c2nccc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C19H16N2O2/c1-23-13-8-6-12(7-9-13)19(22)18-17-15(10-11-20-18)14-4-2-3-5-16(14)21-17/h2-11,19,21-22H,1H3 |
| InChIKey | RPDDNJZUPXCRTA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |