C19H18N2O6 — CID 135060684
methyl 2,3-diacetyloxy-3-(9H-pyrido[3,4-b]indol-1-yl)propanoate (PubChem CID 135060684) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 2,3-diacetyloxy-3-(9H-pyrido[3,4-b]indol-1-yl)propanoate.
| Compound Name | methyl 2,3-diacetyloxy-3-(9H-pyrido[3,4-b]indol-1-yl)propanoate |
|---|---|
| PubChem CID | 135060684 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 2,3-diacetyloxy-3-(9H-pyrido[3,4-b]indol-1-yl)propanoate |
| SMILES | COC(=O)C(OC(C)=O)C(OC(C)=O)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C19H18N2O6/c1-10(22)26-17(18(19(24)25-3)27-11(2)23)16-15-13(8-9-20-16)12-6-4-5-7-14(12)21-15/h4-9,17-18,21H,1-3H3 |
| InChIKey | BGSJVXNPBRPMMP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|