C12H9N3O2 — CID 91488177
9H-pyrido[3,4-b]indol-1-yl carbamate (PubChem CID 91488177) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 9H-pyrido[3,4-b]indol-1-yl carbamate.
| Compound Name | 9H-pyrido[3,4-b]indol-1-yl carbamate |
|---|---|
| PubChem CID | 91488177 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 9H-pyrido[3,4-b]indol-1-yl carbamate |
| SMILES | NC(=O)Oc1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N3O2/c13-12(16)17-11-10-8(5-6-14-11)7-3-1-2-4-9(7)15-10/h1-6,15H,(H2,13,16) |
| InChIKey | DVNHSLXTWVVWIG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |