C16H16N2 — CID 163409626
1-(3-methylbut-2-enyl)-9H-pyrido[3,4-b]indole (PubChem CID 163409626) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 1-(3-methylbut-2-enyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 163409626 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-9H-pyrido[3,4-b]indole |
| SMILES | CC(C)=CCc1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H16N2/c1-11(2)7-8-15-16-13(9-10-17-15)12-5-3-4-6-14(12)18-16/h3-7,9-10,18H,8H2,1-2H3 |
| InChIKey | IHBZBLNIWDCULH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|