C18H21N3 — CID 86173275
1-(2-piperidin-1-ylethyl)-9H-pyrido[3,4-b]indole (PubChem CID 86173275) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-(2-piperidin-1-ylethyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 1-(2-piperidin-1-ylethyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 86173275 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-(2-piperidin-1-ylethyl)-9H-pyrido[3,4-b]indole |
| SMILES | c1ccc2c(c1)[nH]c1c(CCN3CCCCC3)nccc12 |
| InChI | InChI=1S/C18H21N3/c1-4-11-21(12-5-1)13-9-17-18-15(8-10-19-17)14-6-2-3-7-16(14)20-18/h2-3,6-8,10,20H,1,4-5,9,11-13H2 |
| InChIKey | ZHDOGMROBJNEPA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |