C16H15N3 — CID 163547256
N-[(Z)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-1-enyl]ethanimine (PubChem CID 163547256) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is N-[(Z)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-1-enyl]ethanimine.
| Compound Name | N-[(Z)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 163547256 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-[(Z)-3-(9H-pyrido[3,4-b]indol-1-yl)prop-1-enyl]ethanimine |
| SMILES | C/C=N/C=C\Cc1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H15N3/c1-2-17-10-5-8-15-16-13(9-11-18-15)12-6-3-4-7-14(12)19-16/h2-7,9-11,19H,8H2,1H3/b10-5-,17-2+ |
| InChIKey | FGCIGPOTPGZMCJ-QHBOZUIVSA-N |
| XLogP | 3.86 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|