C18H14N2 — CID 134147548
1-(2-methylphenyl)-9H-pyrido[3,4-b]indole (PubChem CID 134147548) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-(2-methylphenyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 1-(2-methylphenyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134147548 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(2-methylphenyl)-9H-pyrido[3,4-b]indole |
| SMILES | Cc1ccccc1-c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C18H14N2/c1-12-6-2-3-7-13(12)17-18-15(10-11-19-17)14-8-4-5-9-16(14)20-18/h2-11,20H,1H3 |
| InChIKey | XUEVJYCRSUMYMN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |