C15H10N4 — CID 175790323
1-pyrimidin-5-yl-9H-pyrido[3,4-b]indole (PubChem CID 175790323) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-pyrimidin-5-yl-9H-pyrido[3,4-b]indole.
| Compound Name | 1-pyrimidin-5-yl-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175790323 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-pyrimidin-5-yl-9H-pyrido[3,4-b]indole |
| SMILES | c1ccc2c(c1)[nH]c1c(-c3cncnc3)nccc12 |
| InChI | InChI=1S/C15H10N4/c1-2-4-13-11(3-1)12-5-6-18-14(15(12)19-13)10-7-16-9-17-8-10/h1-9,19H |
| InChIKey | XRXTUVPZJCDQBD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |