C20H17N3O2 — CID 71415674
ethyl N-[3-(9H-pyrido[3,4-b]indol-1-yl)phenyl]carbamate (PubChem CID 71415674) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is ethyl N-[3-(9H-pyrido[3,4-b]indol-1-yl)phenyl]carbamate.
| Compound Name | ethyl N-[3-(9H-pyrido[3,4-b]indol-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 71415674 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | ethyl N-[3-(9H-pyrido[3,4-b]indol-1-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(-c2nccc3c2[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-25-20(24)22-14-7-5-6-13(12-14)18-19-16(10-11-21-18)15-8-3-4-9-17(15)23-19/h3-12,23H,2H2,1H3,(H,22,24) |
| InChIKey | AQDZYCQXYSAVHC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |