C22H20N2O4 — CID 50923214
ethyl 1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 50923214) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl 1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 50923214 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl 1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C22H20N2O4/c1-4-28-22(25)17-12-15-14-7-5-6-8-16(14)23-21(15)20(24-17)13-9-10-18(26-2)19(11-13)27-3/h5-12,23H,4H2,1-3H3 |
| InChIKey | LJWHZAFQPZGANL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |