C20H17N3O4 — CID 175035016
[1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl] carbamate (PubChem CID 175035016) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl] carbamate.
| Compound Name | [1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl] carbamate |
|---|---|
| PubChem CID | 175035016 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl] carbamate |
| SMILES | COc1ccc(-c2nc(OC(N)=O)cc3c2[nH]c2ccccc23)cc1OC |
| InChI | InChI=1S/C20H17N3O4/c1-25-15-8-7-11(9-16(15)26-2)18-19-13(10-17(23-18)27-20(21)24)12-5-3-4-6-14(12)22-19/h3-10,22H,1-2H3,(H2,21,24) |
| InChIKey | ZEEFOEVLQSJMQG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |