C22H20N4O2 — CID 57392198
1-(4-methoxyphenyl)-N-(propan-2-ylideneamino)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 57392198) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(propan-2-ylideneamino)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-(propan-2-ylideneamino)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 57392198 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(propan-2-ylideneamino)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc(-c2nc(C(=O)NN=C(C)C)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C22H20N4O2/c1-13(2)25-26-22(27)19-12-17-16-6-4-5-7-18(16)23-21(17)20(24-19)14-8-10-15(28-3)11-9-14/h4-12,23H,1-3H3,(H,26,27) |
| InChIKey | WOXBIBPCPNZEOY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|