C20H16ClN3O — CID 172750422
1-(4-chlorophenyl)-N-ethyl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 172750422) has the molecular formula C20H16ClN3O and a molecular weight of 349.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-ethyl-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-ethyl-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 172750422 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-(4-chlorophenyl)-N-ethyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCNC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H16ClN3O/c1-2-22-20(25)17-11-15-14-5-3-4-6-16(14)23-19(15)18(24-17)12-7-9-13(21)10-8-12/h3-11,23H,2H2,1H3,(H,22,25) |
| InChIKey | KHHJZYZZFGIMKA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |