C25H24ClN3O — CID 102022720
4-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]benzo[f]isoquinoline-2-carboxamide (PubChem CID 102022720) has the molecular formula C25H24ClN3O and a molecular weight of 417.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]benzo[f]isoquinoline-2-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]benzo[f]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 102022720 |
| Molecular Formula | C25H24ClN3O |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(dimethylamino)propyl]benzo[f]isoquinoline-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc2c(ccc3ccccc32)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C25H24ClN3O/c1-29(2)15-5-14-27-25(30)23-16-22-20-7-4-3-6-17(20)10-13-21(22)24(28-23)18-8-11-19(26)12-9-18/h3-4,6-13,16H,5,14-15H2,1-2H3,(H,27,30) |
| InChIKey | AIPLFAAPHJQBJU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|