C24H24Cl2N4O — CID 166625635
1-(3,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 166625635) has the molecular formula C24H24Cl2N4O and a molecular weight of 455.39 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 166625635 |
| Molecular Formula | C24H24Cl2N4O |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[3-(dimethylamino)propyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | Cc1cccc2c1[nH]c1c(-c3ccc(Cl)c(Cl)c3)nc(C(=O)NCCCN(C)C)cc12 |
| InChI | InChI=1S/C24H24Cl2N4O/c1-14-6-4-7-16-17-13-20(24(31)27-10-5-11-30(2)3)28-22(23(17)29-21(14)16)15-8-9-18(25)19(26)12-15/h4,6-9,12-13,29H,5,10-11H2,1-3H3,(H,27,31) |
| InChIKey | ONSMOCMCTMDURS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|