C23H22Cl2N4O2 — CID 156869241
1-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethylamino)ethyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 156869241) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethylamino)ethyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethylamino)ethyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 156869241 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethylamino)ethyl]-8-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | Cc1cccc2c1[nH]c1c(-c3ccc(Cl)c(Cl)c3)nc(C(=O)NCCNCCO)cc12 |
| InChI | InChI=1S/C23H22Cl2N4O2/c1-13-3-2-4-15-16-12-19(23(31)27-8-7-26-9-10-30)28-21(22(16)29-20(13)15)14-5-6-17(24)18(25)11-14/h2-6,11-12,26,29-30H,7-10H2,1H3,(H,27,31) |
| InChIKey | PYOCZIYGCLROKQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|