C21H21ClN2O — CID 59672249
1-(2-chlorophenyl)-N-(3-methylbutyl)isoquinoline-3-carboxamide (PubChem CID 59672249) has the molecular formula C21H21ClN2O and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(3-methylbutyl)isoquinoline-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(3-methylbutyl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 59672249 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(3-methylbutyl)isoquinoline-3-carboxamide |
| SMILES | CC(C)CCNC(=O)c1cc2ccccc2c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C21H21ClN2O/c1-14(2)11-12-23-21(25)19-13-15-7-3-4-8-16(15)20(24-19)17-9-5-6-10-18(17)22/h3-10,13-14H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | NTIHMHNDCCSTTO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |