C20H19ClN2O — CID 10947695
N-butan-2-yl-1-(2-chlorophenyl)isoquinoline-3-carboxamide (PubChem CID 10947695) has the molecular formula C20H19ClN2O and a molecular weight of 336.84 g/mol. Its IUPAC name is N-butan-2-yl-1-(2-chlorophenyl)isoquinoline-3-carboxamide.
| Compound Name | N-butan-2-yl-1-(2-chlorophenyl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10947695 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-butan-2-yl-1-(2-chlorophenyl)isoquinoline-3-carboxamide |
| SMILES | CCC(C)N[11C](=O)c1c[11c]2ccccc2c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H19ClN2O/c1-3-13(2)22-20(24)18-12-14-8-4-5-9-15(14)19(23-18)16-10-6-7-11-17(16)21/h4-13H,3H2,1-2H3,(H,22,24)/i14-1,20-1 |
| InChIKey | XXSIYNJKCPZOFQ-ALFSDHBKSA-N |
| XLogP | 5.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |