C20H19ClN2O — CID 141187748
1-(2-chlorophenyl)-N-(2-methylpropyl)isoquinoline-3-carboxamide (PubChem CID 141187748) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2-methylpropyl)isoquinoline-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(2-methylpropyl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 141187748 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2-methylpropyl)isoquinoline-3-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc2ccccc2c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H19ClN2O/c1-13(2)12-22-20(24)18-11-14-7-3-4-8-15(14)19(23-18)16-9-5-6-10-17(16)21/h3-11,13H,12H2,1-2H3,(H,22,24) |
| InChIKey | AXPMWNHKSRHCKP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |