C25H23N5O2 — CID 6314230
N-(3-imidazol-1-ylpropyl)-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 6314230) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 6314230 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1cccc(-c2nc(C(=O)NCCCn3ccnc3)cc3c2[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C25H23N5O2/c1-32-18-7-4-6-17(14-18)23-24-20(19-8-2-3-9-21(19)28-24)15-22(29-23)25(31)27-10-5-12-30-13-11-26-16-30/h2-4,6-9,11,13-16,28H,5,10,12H2,1H3,(H,27,31) |
| InChIKey | NYJLQOCWGWWQNM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|