C26H25N5O2 — CID 6172640
1-(2-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 6172640) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(2-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 6172640 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCOc1ccccc1-c1nc(C(=O)NCCCn2ccnc2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C26H25N5O2/c1-2-33-23-11-6-4-9-19(23)24-25-20(18-8-3-5-10-21(18)29-25)16-22(30-24)26(32)28-12-7-14-31-15-13-27-17-31/h3-6,8-11,13,15-17,29H,2,7,12,14H2,1H3,(H,28,32) |
| InChIKey | VKIUOKHYPPOXEJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|