C25H25N3O3 — CID 6139376
1-(2-ethoxyphenyl)-N-(oxolan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 6139376) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-(oxolan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(2-ethoxyphenyl)-N-(oxolan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 6139376 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-(oxolan-2-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCOc1ccccc1-c1nc(C(=O)NCC2CCCO2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C25H25N3O3/c1-2-30-22-12-6-4-10-18(22)23-24-19(17-9-3-5-11-20(17)27-24)14-21(28-23)25(29)26-15-16-8-7-13-31-16/h3-6,9-12,14,16,27H,2,7-8,13,15H2,1H3,(H,26,29) |
| InChIKey | YBWUNJJLFXHCLN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |