C15H18N2O3 — CID 7554172
4-methoxy-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 7554172) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-methoxy-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 4-methoxy-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 7554172 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-methoxy-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)NC[C@@H]3CCCO3)cc12 |
| InChI | InChI=1S/C15H18N2O3/c1-19-14-6-2-5-12-11(14)8-13(17-12)15(18)16-9-10-4-3-7-20-10/h2,5-6,8,10,17H,3-4,7,9H2,1H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | PVCQCLYUCATUTF-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |