C17H24N3O2+ — CID 7646480
N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-4-methoxy-1H-indole-2-carboxamide (PubChem CID 7646480) has the molecular formula C17H24N3O2+ and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-4-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-4-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 7646480 |
| Molecular Formula | C17H24N3O2+ |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-4-methoxy-1H-indole-2-carboxamide |
| SMILES | CC[NH+]1CCC[C@H]1CNC(=O)c1cc2c(OC)cccc2[nH]1 |
| InChI | InChI=1S/C17H23N3O2/c1-3-20-9-5-6-12(20)11-18-17(21)15-10-13-14(19-15)7-4-8-16(13)22-2/h4,7-8,10,12,19H,3,5-6,9,11H2,1-2H3,(H,18,21)/p+1/t12-/m0/s1 |
| InChIKey | MGXVRMRZCPNQBN-LBPRGKRZSA-O |
| XLogP | 0.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |