C17H23BrN3O+ — CID 7693934
5-bromo-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-methyl-1H-indole-2-carboxamide (PubChem CID 7693934) has the molecular formula C17H23BrN3O+ and a molecular weight of 365.30 g/mol. Its IUPAC name is 5-bromo-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 7693934 |
| Molecular Formula | C17H23BrN3O+ |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-bromo-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-methyl-1H-indole-2-carboxamide |
| SMILES | CC[NH+]1CCC[C@@H]1CNC(=O)c1[nH]c2ccc(Br)cc2c1C |
| InChI | InChI=1S/C17H22BrN3O/c1-3-21-8-4-5-13(21)10-19-17(22)16-11(2)14-9-12(18)6-7-15(14)20-16/h6-7,9,13,20H,3-5,8,10H2,1-2H3,(H,19,22)/p+1/t13-/m1/s1 |
| InChIKey | BMRNUFXPFUUGSX-CYBMUJFWSA-O |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|