C16H19N3O3 — CID 175458153
N'-cyclopropyl-4-methoxy-N'-(2-oxopropyl)-1H-indole-2-carbohydrazide (PubChem CID 175458153) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N'-cyclopropyl-4-methoxy-N'-(2-oxopropyl)-1H-indole-2-carbohydrazide.
| Compound Name | N'-cyclopropyl-4-methoxy-N'-(2-oxopropyl)-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 175458153 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N'-cyclopropyl-4-methoxy-N'-(2-oxopropyl)-1H-indole-2-carbohydrazide |
| SMILES | COc1cccc2[nH]c(C(=O)NN(CC(C)=O)C3CC3)cc12 |
| InChI | InChI=1S/C16H19N3O3/c1-10(20)9-19(11-6-7-11)18-16(21)14-8-12-13(17-14)4-3-5-15(12)22-2/h3-5,8,11,17H,6-7,9H2,1-2H3,(H,18,21) |
| InChIKey | PGQWQIHKCSLTTK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|