C27H23N5O2S — CID 177377918
1-(2-ethoxyphenyl)-3-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]thiourea (PubChem CID 177377918) has the molecular formula C27H23N5O2S and a molecular weight of 481.58 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]thiourea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 177377918 |
| Molecular Formula | C27H23N5O2S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]thiourea |
| SMILES | CCOc1ccccc1NC(=S)NNC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C27H23N5O2S/c1-2-34-23-15-9-8-14-21(23)30-27(35)32-31-26(33)22-16-19-18-12-6-7-13-20(18)28-25(19)24(29-22)17-10-4-3-5-11-17/h3-16,28H,2H2,1H3,(H,31,33)(H2,30,32,35) |
| InChIKey | DUMAWJBKVVCZIC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|