C16H17N5OS — CID 2474342
1-(1H-benzimidazol-2-ylamino)-3-(2-ethoxyphenyl)thiourea (PubChem CID 2474342) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-ylamino)-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-(1H-benzimidazol-2-ylamino)-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2474342 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(1H-benzimidazol-2-ylamino)-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)NNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H17N5OS/c1-2-22-14-10-6-5-9-13(14)19-16(23)21-20-15-17-11-7-3-4-8-12(11)18-15/h3-10H,2H2,1H3,(H2,17,18,20)(H2,19,21,23) |
| InChIKey | SVMTZKFPTCBYHQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|