C9H10N4O — CID 14088792
N'-(1H-benzimidazol-2-yl)acetohydrazide (PubChem CID 14088792) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is N'-(1H-benzimidazol-2-yl)acetohydrazide.
| Compound Name | N'-(1H-benzimidazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 14088792 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N'-(1H-benzimidazol-2-yl)acetohydrazide |
| SMILES | CC(=O)NNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H10N4O/c1-6(14)12-13-9-10-7-4-2-3-5-8(7)11-9/h2-5H,1H3,(H,12,14)(H2,10,11,13) |
| InChIKey | CDCZSUOUCQDXIW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|