C19H18N8O3 — CID 171986665
1,3-bis(1H-benzimidazol-2-ylcarbamoyl)-1,3-dimethylurea (PubChem CID 171986665) has the molecular formula C19H18N8O3 and a molecular weight of 406.41 g/mol. Its IUPAC name is 1,3-bis(1H-benzimidazol-2-ylcarbamoyl)-1,3-dimethylurea.
| Compound Name | 1,3-bis(1H-benzimidazol-2-ylcarbamoyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 171986665 |
| Molecular Formula | C19H18N8O3 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1,3-bis(1H-benzimidazol-2-ylcarbamoyl)-1,3-dimethylurea |
| SMILES | CN(C(=O)Nc1nc2ccccc2[nH]1)C(=O)N(C)C(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H18N8O3/c1-26(17(28)24-15-20-11-7-3-4-8-12(11)21-15)19(30)27(2)18(29)25-16-22-13-9-5-6-10-14(13)23-16/h3-10H,1-2H3,(H2,20,21,24,28)(H2,22,23,25,29) |
| InChIKey | JBMGIQTVLACCCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |