C18H14N2O — CID 130269845
(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanol (PubChem CID 130269845) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is (1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanol.
| Compound Name | (1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanol |
|---|---|
| PubChem CID | 130269845 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanol |
| SMILES | OCc1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H14N2O/c21-11-13-10-15-14-8-4-5-9-16(14)20-18(15)17(19-13)12-6-2-1-3-7-12/h1-10,20-21H,11H2 |
| InChIKey | IBOYCWFRMDQCOL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |