C26H20FN3S2 — CID 122185846
benzyl N-[[1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate (PubChem CID 122185846) has the molecular formula C26H20FN3S2 and a molecular weight of 457.60 g/mol. Its IUPAC name is benzyl N-[[1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate.
| Compound Name | benzyl N-[[1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate |
|---|---|
| PubChem CID | 122185846 |
| Molecular Formula | C26H20FN3S2 |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | benzyl N-[[1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate |
| SMILES | Fc1ccc(-c2nc(CNC(=S)SCc3ccccc3)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C26H20FN3S2/c27-19-12-10-18(11-13-19)24-25-22(21-8-4-5-9-23(21)30-25)14-20(29-24)15-28-26(31)32-16-17-6-2-1-3-7-17/h1-14,30H,15-16H2,(H,28,31) |
| InChIKey | KXVTUVCQHWXQRO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|