C17H16N2 — CID 746501
(1R)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 746501) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (1R)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1R)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 746501 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (1R)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | c1ccc([C@H]2NCCc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C17H16N2/c1-2-6-12(7-3-1)16-17-14(10-11-18-16)13-8-4-5-9-15(13)19-17/h1-9,16,18-19H,10-11H2/t16-/m1/s1 |
| InChIKey | INERHEQVAVQJBO-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|