C42H40N6O2 — CID 141373733
N',N'-bis[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine (PubChem CID 141373733) has the molecular formula C42H40N6O2 and a molecular weight of 660.82 g/mol. Its IUPAC name is N',N'-bis[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine.
| Compound Name | N',N'-bis[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 141373733 |
| Molecular Formula | C42H40N6O2 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | N',N'-bis[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]butane-1,4-diamine |
| SMILES | COc1ccc(-c2nc(CN(CCCCN)Cc3cc4c([nH]c5ccccc54)c(-c4ccc(OC)cc4)n3)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C42H40N6O2/c1-49-31-17-13-27(14-18-31)39-41-35(33-9-3-5-11-37(33)46-41)23-29(44-39)25-48(22-8-7-21-43)26-30-24-36-34-10-4-6-12-38(34)47-42(36)40(45-30)28-15-19-32(50-2)20-16-28/h3-6,9-20,23-24,46-47H,7-8,21-22,25-26,43H2,1-2H3 |
| InChIKey | GKBAMPOAHVFWMS-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|