C23H21N3OS2 — CID 122185839
prop-2-enyl N-[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate (PubChem CID 122185839) has the molecular formula C23H21N3OS2 and a molecular weight of 419.58 g/mol. Its IUPAC name is prop-2-enyl N-[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate.
| Compound Name | prop-2-enyl N-[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate |
|---|---|
| PubChem CID | 122185839 |
| Molecular Formula | C23H21N3OS2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | prop-2-enyl N-[[1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]carbamodithioate |
| SMILES | C=CCSC(=S)NCc1cc2c([nH]c3ccccc32)c(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C23H21N3OS2/c1-3-12-29-23(28)24-14-16-13-19-18-6-4-5-7-20(18)26-22(19)21(25-16)15-8-10-17(27-2)11-9-15/h3-11,13,26H,1,12,14H2,2H3,(H,24,28) |
| InChIKey | LOVDDXFBVJHARX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|