C31H26F3N3O4 — CID 130247495
(E)-N-[[1-[4-(trifluoromethyl)phenyl]-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 130247495) has the molecular formula C31H26F3N3O4 and a molecular weight of 561.56 g/mol. Its IUPAC name is (E)-N-[[1-[4-(trifluoromethyl)phenyl]-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-[4-(trifluoromethyl)phenyl]-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 130247495 |
| Molecular Formula | C31H26F3N3O4 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | (E)-N-[[1-[4-(trifluoromethyl)phenyl]-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2cc3c([nH]c4ccccc43)c(-c3ccc(C(F)(F)F)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C31H26F3N3O4/c1-39-25-14-18(15-26(40-2)30(25)41-3)8-13-27(38)35-17-21-16-23-22-6-4-5-7-24(22)37-29(23)28(36-21)19-9-11-20(12-10-19)31(32,33)34/h4-16,37H,17H2,1-3H3,(H,35,38)/b13-8+ |
| InChIKey | FADIESYDPSYBBZ-MDWZMJQESA-N |
| XLogP | 6.76 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|