C27H21N3O3 — CID 137243925
(E)-3-(3-hydroxyphenyl)-N-[[1-(4-hydroxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide (PubChem CID 137243925) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is (E)-3-(3-hydroxyphenyl)-N-[[1-(4-hydroxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-hydroxyphenyl)-N-[[1-(4-hydroxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 137243925 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (E)-3-(3-hydroxyphenyl)-N-[[1-(4-hydroxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(O)c1)NCc1cc2c([nH]c3ccccc32)c(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C27H21N3O3/c31-20-11-9-18(10-12-20)26-27-23(22-6-1-2-7-24(22)30-27)15-19(29-26)16-28-25(33)13-8-17-4-3-5-21(32)14-17/h1-15,30-32H,16H2,(H,28,33)/b13-8+ |
| InChIKey | RCROPMHDNBFSBO-MDWZMJQESA-N |
| XLogP | 5.12 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|