C22H18FN3O — CID 164615151
(E)-3-(4-fluorophenyl)-N-[(1-methyl-9H-pyrido[3,4-b]indol-3-yl)methyl]prop-2-enamide (PubChem CID 164615151) has the molecular formula C22H18FN3O and a molecular weight of 359.40 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[(1-methyl-9H-pyrido[3,4-b]indol-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[(1-methyl-9H-pyrido[3,4-b]indol-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 164615151 |
| Molecular Formula | C22H18FN3O |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[(1-methyl-9H-pyrido[3,4-b]indol-3-yl)methyl]prop-2-enamide |
| SMILES | Cc1nc(CNC(=O)/C=C/c2ccc(F)cc2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C22H18FN3O/c1-14-22-19(18-4-2-3-5-20(18)26-22)12-17(25-14)13-24-21(27)11-8-15-6-9-16(23)10-7-15/h2-12,26H,13H2,1H3,(H,24,27)/b11-8+ |
| InChIKey | BSEDMYXBQVMPRQ-DHZHZOJOSA-N |
| XLogP | 4.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|