C27H18F3N3O — CID 130247667
(E)-3-(3,5-difluorophenyl)-N-[[1-(3-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide (PubChem CID 130247667) has the molecular formula C27H18F3N3O and a molecular weight of 457.46 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-N-[[1-(3-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-difluorophenyl)-N-[[1-(3-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 130247667 |
| Molecular Formula | C27H18F3N3O |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-N-[[1-(3-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc(F)c1)NCc1cc2c([nH]c3ccccc32)c(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C27H18F3N3O/c28-18-5-3-4-17(12-18)26-27-23(22-6-1-2-7-24(22)33-27)14-21(32-26)15-31-25(34)9-8-16-10-19(29)13-20(30)11-16/h1-14,33H,15H2,(H,31,34)/b9-8+ |
| InChIKey | CAWLEBDSHLBBAK-CMDGGOBGSA-N |
| XLogP | 6.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|