C28H19ClF3N3O — CID 130247492
(E)-N-[[1-(4-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 130247492) has the molecular formula C28H19ClF3N3O and a molecular weight of 505.93 g/mol. Its IUPAC name is (E)-N-[[1-(4-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[1-(4-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130247492 |
| Molecular Formula | C28H19ClF3N3O |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (E)-N-[[1-(4-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)NCc1cc2c([nH]c3ccccc32)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C28H19ClF3N3O/c29-20-12-8-18(9-13-20)26-27-23(22-3-1-2-4-24(22)35-27)15-21(34-26)16-33-25(36)14-7-17-5-10-19(11-6-17)28(30,31)32/h1-15,35H,16H2,(H,33,36)/b14-7+ |
| InChIKey | IIZSFBLLKYXTGV-VGOFMYFVSA-N |
| XLogP | 7.38 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|