C28H23N3O6 — CID 137243907
(E)-N-[[1-(4-hydroxy-3-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide (PubChem CID 137243907) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is (E)-N-[[1-(4-hydroxy-3-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-(4-hydroxy-3-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 137243907 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (E)-N-[[1-(4-hydroxy-3-methoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide |
| SMILES | COc1cc(-c2nc(CNC(=O)/C=C/c3cc(O)c(O)c(O)c3)cc3c2[nH]c2ccccc23)ccc1O |
| InChI | InChI=1S/C28H23N3O6/c1-37-24-12-16(7-8-21(24)32)26-27-19(18-4-2-3-5-20(18)31-27)13-17(30-26)14-29-25(35)9-6-15-10-22(33)28(36)23(34)11-15/h2-13,31-34,36H,14H2,1H3,(H,29,35)/b9-6+ |
| InChIKey | PTURPHLKXVYAGK-RMKNXTFCSA-N |
| XLogP | 4.54 |
| TPSA | 147.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|